About N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide
N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide (PubChem CID 39768880) has the molecular formula C15H17N3O2S
and a molecular weight of 303.39 g/mol. Its IUPAC name is N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide.
Molecular Properties
| Compound Name | N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide |
| PubChem CID | 39768880 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide |
| SMILES | Cc1cnc(NC(=O)CCCNC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C15H17N3O2S/c1-11-10-17-15(21-11)18-13(19)8-5-9-16-14(20)12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | SIZTVUISFFJNDK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide?
The IUPAC name of N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide (CID 39768880) is N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide.
What is the SMILES notation for N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide?
The canonical SMILES for N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide is Cc1cnc(NC(=O)CCCNC(=O)c2ccccc2)s1.
What is the InChIKey of N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide?
The InChIKey is SIZTVUISFFJNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2S/c1-11-10-17-15(21-11)18-13(19)8-5-9-16-14(20)12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9H2,1H3,(H,16,20)(H,17,18,19).
What are the key properties of N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide?
N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide has a molecular weight of 303.39 g/mol, XLogP of 2.60, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]benzamide is sourced from PubChem (CID 39768880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).