C16H20N2O2S — CID 145420181
4-(3,4-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 145420181) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(3,4-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 145420181 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1cnc(NC(=O)CCCOc2ccc(C)c(C)c2)s1 |
| InChI | InChI=1S/C16H20N2O2S/c1-11-6-7-14(9-12(11)2)20-8-4-5-15(19)18-16-17-10-13(3)21-16/h6-7,9-10H,4-5,8H2,1-3H3,(H,17,18,19) |
| InChIKey | KXRCITBNEZBCOS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|