C9H12N2O2S — CID 65416516
N-(5-methyl-1,3-thiazol-2-yl)-4-oxopentanamide (PubChem CID 65416516) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-4-oxopentanamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-4-oxopentanamide |
|---|---|
| PubChem CID | 65416516 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-4-oxopentanamide |
| SMILES | CC(=O)CCC(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C9H12N2O2S/c1-6(12)3-4-8(13)11-9-10-5-7(2)14-9/h5H,3-4H2,1-2H3,(H,10,11,13) |
| InChIKey | SBOAAGKOMOPDFQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |