About 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea
1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea (PubChem CID 59293942) has the molecular formula C6H9N3OS
and a molecular weight of 171.22 g/mol. Its IUPAC name is 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 59293942 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea |
| SMILES | CNC(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C6H9N3OS/c1-4-3-8-6(11-4)9-5(10)7-2/h3H,1-2H3,(H2,7,8,9,10) |
| InChIKey | QPGXMSMNZCQLBW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea (CID 59293942) is 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea is CNC(=O)Nc1ncc(C)s1.
What is the InChIKey of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
The InChIKey is QPGXMSMNZCQLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS/c1-4-3-8-6(11-4)9-5(10)7-2/h3H,1-2H3,(H2,7,8,9,10).
What are the key properties of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea?
1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea has a molecular weight of 171.22 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 59293942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).