C8H10N2OS — CID 3432578
N-(5-methyl-1,3-thiazol-2-yl)cyclopropanecarboxamide (PubChem CID 3432578) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)cyclopropanecarboxamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3432578 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
| SMILES | Cc1cnc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C8H10N2OS/c1-5-4-9-8(12-5)10-7(11)6-2-3-6/h4,6H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | BVLOQNYBUVHSJP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |