C10H16N4O3S2 — CID 47158637
N-(5-methyl-1,3-thiazol-2-yl)-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 47158637) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 47158637 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | Cc1cnc(NC(=O)C2CCN(S(N)(=O)=O)CC2)s1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-7-6-12-10(18-7)13-9(15)8-2-4-14(5-3-8)19(11,16)17/h6,8H,2-5H2,1H3,(H2,11,16,17)(H,12,13,15) |
| InChIKey | BWIBBVXKLAUFDO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |