C13H23N3OS — CID 143962220
ethane;N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide (PubChem CID 143962220) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is ethane;N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide.
| Compound Name | ethane;N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 143962220 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | ethane;N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide |
| SMILES | CC.Cc1cnc(NC(=O)CN2CCCCC2)s1 |
| InChI | InChI=1S/C11H17N3OS.C2H6/c1-9-7-12-11(16-9)13-10(15)8-14-5-3-2-4-6-14;1-2/h7H,2-6,8H2,1H3,(H,12,13,15);1-2H3 |
| InChIKey | XZJDBSPXTNMLGW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |