C16H19N3OS — CID 52730864
N-(5-methyl-1,3-thiazol-2-yl)-3-(pyrrolidin-1-ylmethyl)benzamide (PubChem CID 52730864) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-3-(pyrrolidin-1-ylmethyl)benzamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-3-(pyrrolidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 52730864 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-3-(pyrrolidin-1-ylmethyl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2cccc(CN3CCCC3)c2)s1 |
| InChI | InChI=1S/C16H19N3OS/c1-12-10-17-16(21-12)18-15(20)14-6-4-5-13(9-14)11-19-7-2-3-8-19/h4-6,9-10H,2-3,7-8,11H2,1H3,(H,17,18,20) |
| InChIKey | MHLYISNJTIGKRY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |