C15H19N3O3S2 — CID 2122297
3-(diethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 2122297) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 2122297 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2ncc(C)s2)c1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-4-18(5-2)23(20,21)13-8-6-7-12(9-13)14(19)17-15-16-10-11(3)22-15/h6-10H,4-5H2,1-3H3,(H,16,17,19) |
| InChIKey | VYXANMKGTUGDAP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |