C18H26N4O3S2 — CID 8839583
3-(diethylsulfamoyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 8839583) has the molecular formula C18H26N4O3S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8839583 |
| Molecular Formula | C18H26N4O3S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCc1nnc(NC(=O)c2cccc(S(=O)(=O)N(CC)CC)c2)s1 |
| InChI | InChI=1S/C18H26N4O3S2/c1-4-7-8-12-16-20-21-18(26-16)19-17(23)14-10-9-11-15(13-14)27(24,25)22(5-2)6-3/h9-11,13H,4-8,12H2,1-3H3,(H,19,21,23) |
| InChIKey | LBPNVVLEJWOKPS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|