C15H17N7OS — CID 26209796
N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-(tetrazol-1-yl)benzamide (PubChem CID 26209796) has the molecular formula C15H17N7OS and a molecular weight of 343.42 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 26209796 |
| Molecular Formula | C15H17N7OS |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-(tetrazol-1-yl)benzamide |
| SMILES | CCCCCc1nnc(NC(=O)c2cccc(-n3cnnn3)c2)s1 |
| InChI | InChI=1S/C15H17N7OS/c1-2-3-4-8-13-18-19-15(24-13)17-14(23)11-6-5-7-12(9-11)22-10-16-20-21-22/h5-7,9-10H,2-4,8H2,1H3,(H,17,19,23) |
| InChIKey | DHBJGBSASQYGPG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|