C18H24N4O3S2 — CID 5024814
N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 5024814) has the molecular formula C18H24N4O3S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 5024814 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCCCCc1nnc(NC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)s1 |
| InChI | InChI=1S/C18H24N4O3S2/c1-2-3-4-10-16-20-21-18(26-16)19-17(23)14-8-7-9-15(13-14)27(24,25)22-11-5-6-12-22/h7-9,13H,2-6,10-12H2,1H3,(H,19,21,23) |
| InChIKey | HEHFHTDONUHUTK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|