C14H17N3O3S2 — CID 26197121
N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methylsulfonylbenzamide (PubChem CID 26197121) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methylsulfonylbenzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 26197121 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-methylsulfonylbenzamide |
| SMILES | CCCCc1nnc(NC(=O)c2cccc(S(C)(=O)=O)c2)s1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-3-4-8-12-16-17-14(21-12)15-13(18)10-6-5-7-11(9-10)22(2,19)20/h5-7,9H,3-4,8H2,1-2H3,(H,15,17,18) |
| InChIKey | YSSBCYQCURMILG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |