C19H28FN3OS — CID 169248406
butane;3-fluoro-N-(5-hexyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 169248406) has the molecular formula C19H28FN3OS and a molecular weight of 365.52 g/mol. Its IUPAC name is butane;3-fluoro-N-(5-hexyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | butane;3-fluoro-N-(5-hexyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 169248406 |
| Molecular Formula | C19H28FN3OS |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | butane;3-fluoro-N-(5-hexyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCC.CCCCCCc1nnc(NC(=O)c2cccc(F)c2)s1 |
| InChI | InChI=1S/C15H18FN3OS.C4H10/c1-2-3-4-5-9-13-18-19-15(21-13)17-14(20)11-7-6-8-12(16)10-11;1-3-4-2/h6-8,10H,2-5,9H2,1H3,(H,17,19,20);3-4H2,1-2H3 |
| InChIKey | BMEXCQQMQIRMKR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|