C12H11ClFN3OS — CID 82058053
N-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]-3-fluorobenzamide (PubChem CID 82058053) has the molecular formula C12H11ClFN3OS and a molecular weight of 299.76 g/mol. Its IUPAC name is N-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]-3-fluorobenzamide.
| Compound Name | N-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 82058053 |
| Molecular Formula | C12H11ClFN3OS |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | N-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]-3-fluorobenzamide |
| SMILES | O=C(Nc1nnc(CCCCl)s1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H11ClFN3OS/c13-6-2-5-10-16-17-12(19-10)15-11(18)8-3-1-4-9(14)7-8/h1,3-4,7H,2,5-6H2,(H,15,17,18) |
| InChIKey | AVYWLSPFELJASK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|