C19H27N3O2S2 — CID 46551033
3-(methylsulfinylmethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 46551033) has the molecular formula C19H27N3O2S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 3-(methylsulfinylmethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-(methylsulfinylmethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46551033 |
| Molecular Formula | C19H27N3O2S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 3-(methylsulfinylmethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2cccc(CS(C)=O)c2)s1 |
| InChI | InChI=1S/C19H27N3O2S2/c1-3-4-5-6-7-8-12-17-21-22-19(25-17)20-18(23)16-11-9-10-15(13-16)14-26(2)24/h9-11,13H,3-8,12,14H2,1-2H3,(H,20,22,23) |
| InChIKey | JZFGSCMZEFGQJY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|