C19H27N3O3S — CID 46551224
3,4-dimethoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 46551224) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46551224 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3,4-dimethoxy-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C19H27N3O3S/c1-4-5-6-7-8-9-10-17-21-22-19(26-17)20-18(23)14-11-12-15(24-2)16(13-14)25-3/h11-13H,4-10H2,1-3H3,(H,20,22,23) |
| InChIKey | RJBYPZBSZLUUIY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|