C17H23N3O3S — CID 2208286
2-(3,4-dimethoxyphenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 2208286) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2208286 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCCc1nnc(NC(=O)Cc2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C17H23N3O3S/c1-4-5-6-7-16-19-20-17(24-16)18-15(21)11-12-8-9-13(22-2)14(10-12)23-3/h8-10H,4-7,11H2,1-3H3,(H,18,20,21) |
| InChIKey | ZPOICYJAZRBHEP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|