C15H19N3OS — CID 18198073
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylphenyl)acetamide (PubChem CID 18198073) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylphenyl)acetamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18198073 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(4-methylphenyl)acetamide |
| SMILES | CCCCc1nnc(NC(=O)Cc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C15H19N3OS/c1-3-4-5-14-17-18-15(20-14)16-13(19)10-12-8-6-11(2)7-9-12/h6-9H,3-5,10H2,1-2H3,(H,16,18,19) |
| InChIKey | DFDZWOYZEAFUFJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |