C19H26N4O3S2 — CID 35865489
N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 35865489) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 35865489 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCC(CC)c1nnc(NC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)s1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-3-14(4-2)18-21-22-19(27-18)20-17(24)15-9-8-10-16(13-15)28(25,26)23-11-6-5-7-12-23/h8-10,13-14H,3-7,11-12H2,1-2H3,(H,20,22,24) |
| InChIKey | ZWAXLVMEMDKNNU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |