C20H27N3O3S2 — CID 60571694
3-(diethylsulfamoyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)benzamide (PubChem CID 60571694) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 60571694 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2nc3c(s2)CCCCCC3)c1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-3-23(4-2)28(25,26)16-11-9-10-15(14-16)19(24)22-20-21-17-12-7-5-6-8-13-18(17)27-20/h9-11,14H,3-8,12-13H2,1-2H3,(H,21,22,24) |
| InChIKey | FYPSZVNHEYTALU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |