C9H8N2OS — CID 144888956
N-(5-ethynyl-1,3-thiazol-2-yl)cyclopropanecarboxamide (PubChem CID 144888956) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is N-(5-ethynyl-1,3-thiazol-2-yl)cyclopropanecarboxamide.
| Compound Name | N-(5-ethynyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 144888956 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | N-(5-ethynyl-1,3-thiazol-2-yl)cyclopropanecarboxamide |
| SMILES | C#Cc1cnc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C9H8N2OS/c1-2-7-5-10-9(13-7)11-8(12)6-3-4-6/h1,5-6H,3-4H2,(H,10,11,12) |
| InChIKey | KXKVSEYMGHYTER-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|