C10H14BrN3OS — CID 60849806
4-amino-N-(5-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 60849806) has the molecular formula C10H14BrN3OS and a molecular weight of 304.21 g/mol. Its IUPAC name is 4-amino-N-(5-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(5-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 60849806 |
| Molecular Formula | C10H14BrN3OS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 4-amino-N-(5-bromo-1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2ncc(Br)s2)CC1 |
| InChI | InChI=1S/C10H14BrN3OS/c11-8-5-13-10(16-8)14-9(15)6-1-3-7(12)4-2-6/h5-7H,1-4,12H2,(H,13,14,15) |
| InChIKey | QDBAPQDFMAIEFF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |