C7H9F2N3OS — CID 124607917
1-(2,2-difluoroethyl)-3-(5-methyl-1,3-thiazol-2-yl)urea (PubChem CID 124607917) has the molecular formula C7H9F2N3OS and a molecular weight of 221.23 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-(5-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(2,2-difluoroethyl)-3-(5-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 124607917 |
| Molecular Formula | C7H9F2N3OS |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-(5-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1cnc(NC(=O)NCC(F)F)s1 |
| InChI | InChI=1S/C7H9F2N3OS/c1-4-2-11-7(14-4)12-6(13)10-3-5(8)9/h2,5H,3H2,1H3,(H2,10,11,12,13) |
| InChIKey | DZYRAPAMRAILQT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |