C9H15N3O2S — CID 71931128
1-(3-hydroxybutyl)-3-(5-methyl-1,3-thiazol-2-yl)urea (PubChem CID 71931128) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 1-(3-hydroxybutyl)-3-(5-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(3-hydroxybutyl)-3-(5-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 71931128 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(3-hydroxybutyl)-3-(5-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1cnc(NC(=O)NCCC(C)O)s1 |
| InChI | InChI=1S/C9H15N3O2S/c1-6(13)3-4-10-8(14)12-9-11-5-7(2)15-9/h5-6,13H,3-4H2,1-2H3,(H2,10,11,12,14) |
| InChIKey | VZFWHUASQGVXAG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |