C9H13N3O3S — CID 43384951
ethyl 2-[(5-methyl-1,3-thiazol-2-yl)carbamoylamino]acetate (PubChem CID 43384951) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is ethyl 2-[(5-methyl-1,3-thiazol-2-yl)carbamoylamino]acetate.
| Compound Name | ethyl 2-[(5-methyl-1,3-thiazol-2-yl)carbamoylamino]acetate |
|---|---|
| PubChem CID | 43384951 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | ethyl 2-[(5-methyl-1,3-thiazol-2-yl)carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ncc(C)s1 |
| InChI | InChI=1S/C9H13N3O3S/c1-3-15-7(13)5-10-8(14)12-9-11-4-6(2)16-9/h4H,3,5H2,1-2H3,(H2,10,11,12,14) |
| InChIKey | SXYJGGRFBVPWPB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |