C8H10ClN3O2S — CID 43146246
2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]propanamide (PubChem CID 43146246) has the molecular formula C8H10ClN3O2S and a molecular weight of 247.71 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 43146246 |
| Molecular Formula | C8H10ClN3O2S |
| Molecular Weight | 247.71 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-chloro-N-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]propanamide |
| SMILES | Cc1cnc(NC(=O)NC(=O)C(C)Cl)s1 |
| InChI | InChI=1S/C8H10ClN3O2S/c1-4-3-10-8(15-4)12-7(14)11-6(13)5(2)9/h3,5H,1-2H3,(H2,10,11,12,13,14) |
| InChIKey | WSYXHXYKOHAKNV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|