C23H20N2O4 — CID 3493766
[2-(3-methylanilino)-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 3493766) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] 2-benzamidobenzoate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 3493766 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)c2ccccc2NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20N2O4/c1-16-8-7-11-18(14-16)24-21(26)15-29-23(28)19-12-5-6-13-20(19)25-22(27)17-9-3-2-4-10-17/h2-14H,15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | UCFOAUQKIOXPDR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |