C25H24N2O7 — CID 2525027
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-benzamidobenzoate (PubChem CID 2525027) has the molecular formula C25H24N2O7 and a molecular weight of 464.47 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-benzamidobenzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 2525027 |
| Molecular Formula | C25H24N2O7 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-benzamidobenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccccc2NC(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N2O7/c1-31-20-13-17(14-21(32-2)23(20)33-3)26-22(28)15-34-25(30)18-11-7-8-12-19(18)27-24(29)16-9-5-4-6-10-16/h4-14H,15H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | YDOZWFJLUVKGSF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |