About [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate
[2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 1217734) has the molecular formula C23H19NO5
and a molecular weight of 389.41 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate.
Molecular Properties
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate |
| PubChem CID | 1217734 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | COc1cccc(C(=O)COC(=O)c2ccccc2NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H19NO5/c1-28-18-11-7-10-17(14-18)21(25)15-29-23(27)19-12-5-6-13-20(19)24-22(26)16-8-3-2-4-9-16/h2-14H,15H2,1H3,(H,24,26) |
| InChIKey | PJEBHQJNQWEKIY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate?
The IUPAC name of [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate (CID 1217734) is [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate.
What is the SMILES notation for [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate?
The canonical SMILES for [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate is COc1cccc(C(=O)COC(=O)c2ccccc2NC(=O)c2ccccc2)c1.
What is the InChIKey of [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate?
The InChIKey is PJEBHQJNQWEKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO5/c1-28-18-11-7-10-17(14-18)21(25)15-29-23(27)19-12-5-6-13-20(19)24-22(26)16-8-3-2-4-9-16/h2-14H,15H2,1H3,(H,24,26).
What are the key properties of [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate?
[2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate has a molecular weight of 389.41 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-methoxyphenyl)-2-oxoethyl] 2-benzamidobenzoate is sourced from PubChem (CID 1217734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).