About [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate
[3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate (PubChem CID 154371121) has the molecular formula C34H24N2O6
and a molecular weight of 556.57 g/mol. Its IUPAC name is [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate.
Molecular Properties
| Compound Name | [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate |
| PubChem CID | 154371121 |
| Molecular Formula | C34H24N2O6 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate |
| SMILES | O=C(Nc1ccccc1C(=O)Oc1cccc(OC(=O)c2ccccc2NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C34H24N2O6/c37-31(23-12-3-1-4-13-23)35-29-20-9-7-18-27(29)33(39)41-25-16-11-17-26(22-25)42-34(40)28-19-8-10-21-30(28)36-32(38)24-14-5-2-6-15-24/h1-22H,(H,35,37)(H,36,38) |
| InChIKey | GODQNXMBSQIUSP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate?
The IUPAC name of [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate (CID 154371121) is [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate.
What is the SMILES notation for [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate?
The canonical SMILES for [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate is O=C(Nc1ccccc1C(=O)Oc1cccc(OC(=O)c2ccccc2NC(=O)c2ccccc2)c1)c1ccccc1.
What is the InChIKey of [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate?
The InChIKey is GODQNXMBSQIUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H24N2O6/c37-31(23-12-3-1-4-13-23)35-29-20-9-7-18-27(29)33(39)41-25-16-11-17-26(22-25)42-34(40)28-19-8-10-21-30(28)36-32(38)24-14-5-2-6-15-24/h1-22H,(H,35,37)(H,36,38).
What are the key properties of [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate?
[3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate has a molecular weight of 556.57 g/mol, XLogP of 6.63, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-benzamidobenzoyl)oxyphenyl] 2-benzamidobenzoate is sourced from PubChem (CID 154371121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).