C18H17Cl2NO6 — CID 2487542
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2,5-dichlorobenzoate (PubChem CID 2487542) has the molecular formula C18H17Cl2NO6 and a molecular weight of 414.24 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2,5-dichlorobenzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2487542 |
| Molecular Formula | C18H17Cl2NO6 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2,5-dichlorobenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(Cl)ccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H17Cl2NO6/c1-24-14-7-11(8-15(25-2)17(14)26-3)21-16(22)9-27-18(23)12-6-10(19)4-5-13(12)20/h4-8H,9H2,1-3H3,(H,21,22) |
| InChIKey | VCYZJXQQWGFWFR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |