C17H14ClF2NO5 — CID 2565957
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2565957) has the molecular formula C17H14ClF2NO5 and a molecular weight of 385.75 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2565957 |
| Molecular Formula | C17H14ClF2NO5 |
| Molecular Weight | 385.75 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(F)c(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C17H14ClF2NO5/c1-24-14-4-3-9(5-15(14)25-2)21-16(22)8-26-17(23)10-6-12(19)13(20)7-11(10)18/h3-7H,8H2,1-2H3,(H,21,22) |
| InChIKey | NZCSIRQOYNRCTA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.75 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|