C16H9Cl2F4NO4 — CID 16528284
[2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 16528284) has the molecular formula C16H9Cl2F4NO4 and a molecular weight of 426.15 g/mol. Its IUPAC name is [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 16528284 |
| Molecular Formula | C16H9Cl2F4NO4 |
| Molecular Weight | 426.15 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | [2-[3-chloro-4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)cc1Cl)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H9Cl2F4NO4/c17-9-5-12(20)11(19)4-8(9)15(25)26-6-14(24)23-7-1-2-13(10(18)3-7)27-16(21)22/h1-5,16H,6H2,(H,23,24) |
| InChIKey | BWWXGYNDIVBFFP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.15 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|