C15H8Cl2F3NO3 — CID 7809812
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7809812) has the molecular formula C15H8Cl2F3NO3 and a molecular weight of 378.13 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7809812 |
| Molecular Formula | C15H8Cl2F3NO3 |
| Molecular Weight | 378.13 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)cc1Cl)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H8Cl2F3NO3/c16-7-1-2-10(18)13(3-7)21-14(22)6-24-15(23)8-4-11(19)12(20)5-9(8)17/h1-5H,6H2,(H,21,22) |
| InChIKey | HSCANHVWCOUGPG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.13 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|