C15H8Br2ClF2NO3 — CID 2432324
[2-(2,4-dibromoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2432324) has the molecular formula C15H8Br2ClF2NO3 and a molecular weight of 483.49 g/mol. Its IUPAC name is [2-(2,4-dibromoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(2,4-dibromoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2432324 |
| Molecular Formula | C15H8Br2ClF2NO3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 480.85 |
| IUPAC Name | [2-(2,4-dibromoanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)cc1Cl)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H8Br2ClF2NO3/c16-7-1-2-13(9(17)3-7)21-14(22)6-24-15(23)8-4-11(19)12(20)5-10(8)18/h1-5H,6H2,(H,21,22) |
| InChIKey | HPRIWXRTRHNZLU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|