C16H11ClF2N2O4 — CID 7809950
[2-(2-carbamoylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7809950) has the molecular formula C16H11ClF2N2O4 and a molecular weight of 368.72 g/mol. Its IUPAC name is [2-(2-carbamoylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7809950 |
| Molecular Formula | C16H11ClF2N2O4 |
| Molecular Weight | 368.72 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | NC(=O)c1ccccc1NC(=O)COC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H11ClF2N2O4/c17-10-6-12(19)11(18)5-9(10)16(24)25-7-14(22)21-13-4-2-1-3-8(13)15(20)23/h1-6H,7H2,(H2,20,23)(H,21,22) |
| InChIKey | GNBZKHXWHSEAGR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|