C19H17ClF2N2O4 — CID 7382611
[2-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7382611) has the molecular formula C19H17ClF2N2O4 and a molecular weight of 410.80 g/mol. Its IUPAC name is [2-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7382611 |
| Molecular Formula | C19H17ClF2N2O4 |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | [2-[[2-(2,3-dimethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | Cc1cccc(NC(=O)CNC(=O)COC(=O)c2cc(F)c(F)cc2Cl)c1C |
| InChI | InChI=1S/C19H17ClF2N2O4/c1-10-4-3-5-16(11(10)2)24-17(25)8-23-18(26)9-28-19(27)12-6-14(21)15(22)7-13(12)20/h3-7H,8-9H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | JZPIAEKHKNFBPB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|