C17H12BrClF2N2O4 — CID 55397271
[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 55397271) has the molecular formula C17H12BrClF2N2O4 and a molecular weight of 461.65 g/mol. Its IUPAC name is [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 55397271 |
| Molecular Formula | C17H12BrClF2N2O4 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)cc1Cl)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C17H12BrClF2N2O4/c18-10-3-1-2-4-14(10)23-15(24)7-22-16(25)8-27-17(26)9-5-12(20)13(21)6-11(9)19/h1-6H,7-8H2,(H,22,25)(H,23,24) |
| InChIKey | LZOHBIHIAWTRCQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|