C17H11BrClF3N2O4 — CID 16524641
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-bromo-2-chlorobenzoate (PubChem CID 16524641) has the molecular formula C17H11BrClF3N2O4 and a molecular weight of 479.64 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 16524641 |
| Molecular Formula | C17H11BrClF3N2O4 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-bromo-2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1Cl)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H11BrClF3N2O4/c18-8-1-2-10(19)9(5-8)17(27)28-7-14(26)23-6-13(25)24-12-4-3-11(20)15(21)16(12)22/h1-5H,6-7H2,(H,23,26)(H,24,25) |
| InChIKey | ABATVQDTJJRCHN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|