C17H14Cl2FNO5 — CID 8649155
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8649155) has the molecular formula C17H14Cl2FNO5 and a molecular weight of 402.21 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8649155 |
| Molecular Formula | C17H14Cl2FNO5 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(F)c(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C17H14Cl2FNO5/c1-24-14-4-3-9(5-15(14)25-2)21-16(22)8-26-17(23)10-6-13(20)12(19)7-11(10)18/h3-7H,8H2,1-2H3,(H,21,22) |
| InChIKey | HTCNLQKAVFVHBR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|