C17H11Cl2F2NO4 — CID 8653025
[2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8653025) has the molecular formula C17H11Cl2F2NO4 and a molecular weight of 402.18 g/mol. Its IUPAC name is [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8653025 |
| Molecular Formula | C17H11Cl2F2NO4 |
| Molecular Weight | 402.18 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)COC(=O)c2cc(F)c(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C17H11Cl2F2NO4/c1-8(23)22-9-2-3-10(14(20)4-9)16(24)7-26-17(25)11-5-15(21)13(19)6-12(11)18/h2-6H,7H2,1H3,(H,22,23) |
| InChIKey | PZRJQEABRFBMNU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.18 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|