C19H25FN2O6 — CID 8949061
[2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 8949061) has the molecular formula C19H25FN2O6 and a molecular weight of 396.42 g/mol. Its IUPAC name is [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 8949061 |
| Molecular Formula | C19H25FN2O6 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(4-acetamido-2-fluorophenyl)-2-oxoethyl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(=O)Nc1ccc(C(=O)COC(=O)CCCNC(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C19H25FN2O6/c1-12(23)22-13-7-8-14(15(20)10-13)16(24)11-27-17(25)6-5-9-21-18(26)28-19(2,3)4/h7-8,10H,5-6,9,11H2,1-4H3,(H,21,26)(H,22,23) |
| InChIKey | WUBXLOOBEPAUAP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|