C17H12Cl2FNO4 — CID 8650177
[2-(4-acetamidophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8650177) has the molecular formula C17H12Cl2FNO4 and a molecular weight of 384.19 g/mol. Its IUPAC name is [2-(4-acetamidophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [2-(4-acetamidophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8650177 |
| Molecular Formula | C17H12Cl2FNO4 |
| Molecular Weight | 384.19 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | [2-(4-acetamidophenyl)-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)COC(=O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H12Cl2FNO4/c1-9(22)21-11-4-2-10(3-5-11)16(23)8-25-17(24)12-6-15(20)14(19)7-13(12)18/h2-7H,8H2,1H3,(H,21,22) |
| InChIKey | NNGZREFNXIGGJS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|