C18H16BrCl2NO6 — CID 1191671
[2-(3,5-dichloroanilino)-2-oxoethyl] 2-bromo-3,4,5-trimethoxybenzoate (PubChem CID 1191671) has the molecular formula C18H16BrCl2NO6 and a molecular weight of 493.14 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] 2-bromo-3,4,5-trimethoxybenzoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-bromo-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 1191671 |
| Molecular Formula | C18H16BrCl2NO6 |
| Molecular Weight | 493.14 g/mol |
| Exact Mass | 490.95 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 2-bromo-3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2cc(Cl)cc(Cl)c2)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C18H16BrCl2NO6/c1-25-13-7-12(15(19)17(27-3)16(13)26-2)18(24)28-8-14(23)22-11-5-9(20)4-10(21)6-11/h4-7H,8H2,1-3H3,(H,22,23) |
| InChIKey | RDXJYQPPNAEUPP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.14 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |