C25H24N2O4 — CID 7982581
[2-(2,5-dimethylanilino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]benzoate (PubChem CID 7982581) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]benzoate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 7982581 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]benzoate |
| SMILES | Cc1cccc(C(=O)Nc2ccccc2C(=O)OCC(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-16-7-6-8-19(13-16)24(29)27-21-10-5-4-9-20(21)25(30)31-15-23(28)26-22-14-17(2)11-12-18(22)3/h4-14H,15H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | STWYECCRQGKHLE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |