C24H23N3O6S — CID 42981396
[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-[(3-methylbenzoyl)amino]benzoate (PubChem CID 42981396) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-[(3-methylbenzoyl)amino]benzoate.
| Compound Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-[(3-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 42981396 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-[(3-methylbenzoyl)amino]benzoate |
| SMILES | Cc1cccc(C(=O)Nc2ccccc2C(=O)OCC(=O)NCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C24H23N3O6S/c1-16-5-4-6-18(13-16)23(29)27-21-8-3-2-7-20(21)24(30)33-15-22(28)26-14-17-9-11-19(12-10-17)34(25,31)32/h2-13H,14-15H2,1H3,(H,26,28)(H,27,29)(H2,25,31,32) |
| InChIKey | MHIYCLATQQSABT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |