About [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate
[2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 7865591) has the molecular formula C22H16N2O6
and a molecular weight of 404.38 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate.
Molecular Properties
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate |
| PubChem CID | 7865591 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1ccccc1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16N2O6/c25-20(23-18-12-6-7-13-19(18)24(28)29)14-30-22(27)17-11-5-4-10-16(17)21(26)15-8-2-1-3-9-15/h1-13H,14H2,(H,23,25) |
| InChIKey | DXJNZEXBZKVTBQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate?
The IUPAC name of [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate (CID 7865591) is [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate.
What is the SMILES notation for [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate?
The canonical SMILES for [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate is O=C(COC(=O)c1ccccc1C(=O)c1ccccc1)Nc1ccccc1[N+](=O)[O-].
What is the InChIKey of [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate?
The InChIKey is DXJNZEXBZKVTBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O6/c25-20(23-18-12-6-7-13-19(18)24(28)29)14-30-22(27)17-11-5-4-10-16(17)21(26)15-8-2-1-3-9-15/h1-13H,14H2,(H,23,25).
What are the key properties of [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate?
[2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate has a molecular weight of 404.38 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-nitroanilino)-2-oxoethyl] 2-benzoylbenzoate is sourced from PubChem (CID 7865591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).