C16H13BrFNO3 — CID 7775273
[2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-bromobenzoate (PubChem CID 7775273) has the molecular formula C16H13BrFNO3 and a molecular weight of 366.19 g/mol. Its IUPAC name is [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-bromobenzoate.
| Compound Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 7775273 |
| Molecular Formula | C16H13BrFNO3 |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-bromobenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccccc2Br)c(F)c1 |
| InChI | InChI=1S/C16H13BrFNO3/c1-10-6-7-14(13(18)8-10)19-15(20)9-22-16(21)11-4-2-3-5-12(11)17/h2-8H,9H2,1H3,(H,19,20) |
| InChIKey | BXNAJAPXTQJGKF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |