C17H15BrFNO3 — CID 7796359
[2-(2-bromo-4-methylanilino)-2-oxoethyl] 2-(2-fluorophenyl)acetate (PubChem CID 7796359) has the molecular formula C17H15BrFNO3 and a molecular weight of 380.21 g/mol. Its IUPAC name is [2-(2-bromo-4-methylanilino)-2-oxoethyl] 2-(2-fluorophenyl)acetate.
| Compound Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] 2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7796359 |
| Molecular Formula | C17H15BrFNO3 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl] 2-(2-fluorophenyl)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)Cc2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C17H15BrFNO3/c1-11-6-7-15(13(18)8-11)20-16(21)10-23-17(22)9-12-4-2-3-5-14(12)19/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | RXUMAFWSSXBCOC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |